C13H10BrNO5 — CID 106851150
2-[(2-bromofuran-3-carbonyl)amino]-5-methoxybenzoic acid (PubChem CID 106851150) has the molecular formula C13H10BrNO5 and a molecular weight of 340.13 g/mol. Its IUPAC name is 2-[(2-bromofuran-3-carbonyl)amino]-5-methoxybenzoic acid.
| Compound Name | 2-[(2-bromofuran-3-carbonyl)amino]-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 106851150 |
| Molecular Formula | C13H10BrNO5 |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.97 |
| IUPAC Name | 2-[(2-bromofuran-3-carbonyl)amino]-5-methoxybenzoic acid |
| SMILES | COc1ccc(NC(=O)c2ccoc2Br)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H10BrNO5/c1-19-7-2-3-10(9(6-7)13(17)18)15-12(16)8-4-5-20-11(8)14/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | RCIQRCDXAXAXMK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |