C13H12N2O5 — CID 78980914
5-methoxy-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzoic acid (PubChem CID 78980914) has the molecular formula C13H12N2O5 and a molecular weight of 276.25 g/mol. Its IUPAC name is 5-methoxy-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzoic acid.
| Compound Name | 5-methoxy-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 78980914 |
| Molecular Formula | C13H12N2O5 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 5-methoxy-2-[(5-methyl-1,2-oxazole-3-carbonyl)amino]benzoic acid |
| SMILES | COc1ccc(NC(=O)c2cc(C)on2)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H12N2O5/c1-7-5-11(15-20-7)12(16)14-10-4-3-8(19-2)6-9(10)13(17)18/h3-6H,1-2H3,(H,14,16)(H,17,18) |
| InChIKey | JYEFSVMOTDKMCY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |