C12H7Cl3N2O3 — CID 61398560
2-chloro-4-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]benzoic acid (PubChem CID 61398560) has the molecular formula C12H7Cl3N2O3 and a molecular weight of 333.56 g/mol. Its IUPAC name is 2-chloro-4-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 61398560 |
| Molecular Formula | C12H7Cl3N2O3 |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 331.95 |
| IUPAC Name | 2-chloro-4-[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(Nc1ccc(C(=O)O)c(Cl)c1)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C12H7Cl3N2O3/c13-7-3-5(1-2-6(7)12(19)20)16-11(18)9-4-8(14)10(15)17-9/h1-4,17H,(H,16,18)(H,19,20) |
| InChIKey | LNDOZBWQJBKHLK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |