C13H11Cl2N3O2 — CID 31301489
N-(3-acetamidophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide (PubChem CID 31301489) has the molecular formula C13H11Cl2N3O2 and a molecular weight of 312.16 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(3-acetamidophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 31301489 |
| Molecular Formula | C13H11Cl2N3O2 |
| Molecular Weight | 312.16 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | N-(3-acetamidophenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2cc(Cl)c(Cl)[nH]2)c1 |
| InChI | InChI=1S/C13H11Cl2N3O2/c1-7(19)16-8-3-2-4-9(5-8)17-13(20)11-6-10(14)12(15)18-11/h2-6,18H,1H3,(H,16,19)(H,17,20) |
| InChIKey | UFUQPOYTXHURSA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.16 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |