C12H9BrCl2N2O — CID 43806529
N-(5-bromo-2-methylphenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide (PubChem CID 43806529) has the molecular formula C12H9BrCl2N2O and a molecular weight of 348.03 g/mol. Its IUPAC name is N-(5-bromo-2-methylphenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide.
| Compound Name | N-(5-bromo-2-methylphenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43806529 |
| Molecular Formula | C12H9BrCl2N2O |
| Molecular Weight | 348.03 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | N-(5-bromo-2-methylphenyl)-4,5-dichloro-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(Br)cc1NC(=O)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C12H9BrCl2N2O/c1-6-2-3-7(13)4-9(6)17-12(18)10-5-8(14)11(15)16-10/h2-5,16H,1H3,(H,17,18) |
| InChIKey | JZOYIRHGSPQEGR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.03 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |