C11H7Cl2N3O4 — CID 107745266
4,5-dichloro-N-(2-hydroxy-4-nitrophenyl)-1H-pyrrole-2-carboxamide (PubChem CID 107745266) has the molecular formula C11H7Cl2N3O4 and a molecular weight of 316.10 g/mol. Its IUPAC name is 4,5-dichloro-N-(2-hydroxy-4-nitrophenyl)-1H-pyrrole-2-carboxamide.
| Compound Name | 4,5-dichloro-N-(2-hydroxy-4-nitrophenyl)-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 107745266 |
| Molecular Formula | C11H7Cl2N3O4 |
| Molecular Weight | 316.10 g/mol |
| Exact Mass | 314.98 |
| IUPAC Name | 4,5-dichloro-N-(2-hydroxy-4-nitrophenyl)-1H-pyrrole-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)c1cc(Cl)c(Cl)[nH]1 |
| InChI | InChI=1S/C11H7Cl2N3O4/c12-6-4-8(14-10(6)13)11(18)15-7-2-1-5(16(19)20)3-9(7)17/h1-4,14,17H,(H,15,18) |
| InChIKey | LESGLLDZCDTRBR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 108.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.10 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|