C10H10N4O4 — CID 91901923
N-(2-hydroxy-4-nitrophenyl)-4,5-dihydro-1H-imidazole-2-carboxamide (PubChem CID 91901923) has the molecular formula C10H10N4O4 and a molecular weight of 250.21 g/mol. Its IUPAC name is N-(2-hydroxy-4-nitrophenyl)-4,5-dihydro-1H-imidazole-2-carboxamide.
| Compound Name | N-(2-hydroxy-4-nitrophenyl)-4,5-dihydro-1H-imidazole-2-carboxamide |
|---|---|
| PubChem CID | 91901923 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | N-(2-hydroxy-4-nitrophenyl)-4,5-dihydro-1H-imidazole-2-carboxamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1O)C1=NCCN1 |
| InChI | InChI=1S/C10H10N4O4/c15-8-5-6(14(17)18)1-2-7(8)13-10(16)9-11-3-4-12-9/h1-2,5,15H,3-4H2,(H,11,12)(H,13,16) |
| InChIKey | QKSAFJRQSQLYPO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 116.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|