C11H7F2N3O3 — CID 55129854
4,5-difluoro-2-(1H-pyrazole-4-carbonylamino)benzoic acid (PubChem CID 55129854) has the molecular formula C11H7F2N3O3 and a molecular weight of 267.19 g/mol. Its IUPAC name is 4,5-difluoro-2-(1H-pyrazole-4-carbonylamino)benzoic acid.
| Compound Name | 4,5-difluoro-2-(1H-pyrazole-4-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 55129854 |
| Molecular Formula | C11H7F2N3O3 |
| Molecular Weight | 267.19 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4,5-difluoro-2-(1H-pyrazole-4-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1cc(F)c(F)cc1C(=O)O)c1cn[nH]c1 |
| InChI | InChI=1S/C11H7F2N3O3/c12-7-1-6(11(18)19)9(2-8(7)13)16-10(17)5-3-14-15-4-5/h1-4H,(H,14,15)(H,16,17)(H,18,19) |
| InChIKey | WLVKMGRSBKYSCC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |