C16H16FN5O3 — CID 156642630
2-[[(2Z,4Z)-2,5-diamino-5-(1H-pyrazol-4-yl)penta-2,4-dienoyl]amino]-5-fluoro-4-methylbenzoic acid (PubChem CID 156642630) has the molecular formula C16H16FN5O3 and a molecular weight of 345.33 g/mol. Its IUPAC name is 2-[[(2Z,4Z)-2,5-diamino-5-(1H-pyrazol-4-yl)penta-2,4-dienoyl]amino]-5-fluoro-4-methylbenzoic acid.
| Compound Name | 2-[[(2Z,4Z)-2,5-diamino-5-(1H-pyrazol-4-yl)penta-2,4-dienoyl]amino]-5-fluoro-4-methylbenzoic acid |
|---|---|
| PubChem CID | 156642630 |
| Molecular Formula | C16H16FN5O3 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[[(2Z,4Z)-2,5-diamino-5-(1H-pyrazol-4-yl)penta-2,4-dienoyl]amino]-5-fluoro-4-methylbenzoic acid |
| SMILES | Cc1cc(NC(=O)/C(N)=C/C=C(\N)c2cn[nH]c2)c(C(=O)O)cc1F |
| InChI | InChI=1S/C16H16FN5O3/c1-8-4-14(10(16(24)25)5-11(8)17)22-15(23)13(19)3-2-12(18)9-6-20-21-7-9/h2-7H,18-19H2,1H3,(H,20,21)(H,22,23)(H,24,25)/b12-2-,13-3- |
| InChIKey | RPZRVSLAAWVJDM-CWXBZEISSA-N |
| XLogP | 1.34 |
| TPSA | 147.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|