C9H11FN2O — CID 130686270
(4-fluoro-2,5-dimethylphenyl)urea (PubChem CID 130686270) has the molecular formula C9H11FN2O and a molecular weight of 182.20 g/mol. Its IUPAC name is (4-fluoro-2,5-dimethylphenyl)urea.
| Compound Name | (4-fluoro-2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 130686270 |
| Molecular Formula | C9H11FN2O |
| Molecular Weight | 182.20 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (4-fluoro-2,5-dimethylphenyl)urea |
| SMILES | Cc1cc(NC(N)=O)c(C)cc1F |
| InChI | InChI=1S/C9H11FN2O/c1-5-4-8(12-9(11)13)6(2)3-7(5)10/h3-4H,1-2H3,(H3,11,12,13) |
| InChIKey | UJKNSXMJQXSXNH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.20 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |