C10H12FNO — CID 88834231
N-(2,4,5-trimethylphenyl)carbamoyl fluoride (PubChem CID 88834231) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is N-(2,4,5-trimethylphenyl)carbamoyl fluoride.
| Compound Name | N-(2,4,5-trimethylphenyl)carbamoyl fluoride |
|---|---|
| PubChem CID | 88834231 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-(2,4,5-trimethylphenyl)carbamoyl fluoride |
| SMILES | Cc1cc(C)c(NC(=O)F)cc1C |
| InChI | InChI=1S/C10H12FNO/c1-6-4-8(3)9(5-7(6)2)12-10(11)13/h4-5H,1-3H3,(H,12,13) |
| InChIKey | VYPXZTXMQXNIHN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|