C13H20N2O2 — CID 19967375
1-hydroxy-1-propan-2-yl-3-(2,4,5-trimethylphenyl)urea (PubChem CID 19967375) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-hydroxy-1-propan-2-yl-3-(2,4,5-trimethylphenyl)urea.
| Compound Name | 1-hydroxy-1-propan-2-yl-3-(2,4,5-trimethylphenyl)urea |
|---|---|
| PubChem CID | 19967375 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-hydroxy-1-propan-2-yl-3-(2,4,5-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N(O)C(C)C)cc1C |
| InChI | InChI=1S/C13H20N2O2/c1-8(2)15(17)13(16)14-12-7-10(4)9(3)6-11(12)5/h6-8,17H,1-5H3,(H,14,16) |
| InChIKey | MXUJUXFTGCXMIK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|