C14H22N2O3 — CID 3463712
1-(2,2-dimethoxyethyl)-3-(2,4,5-trimethylphenyl)urea (PubChem CID 3463712) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-(2,4,5-trimethylphenyl)urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-(2,4,5-trimethylphenyl)urea |
|---|---|
| PubChem CID | 3463712 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-(2,4,5-trimethylphenyl)urea |
| SMILES | COC(CNC(=O)Nc1cc(C)c(C)cc1C)OC |
| InChI | InChI=1S/C14H22N2O3/c1-9-6-11(3)12(7-10(9)2)16-14(17)15-8-13(18-4)19-5/h6-7,13H,8H2,1-5H3,(H2,15,16,17) |
| InChIKey | VEYGIAIZLNHATQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|