C11H16N2O3S — CID 108886467
1-(2,2-dimethoxyethyl)-3-(2-sulfanylphenyl)urea (PubChem CID 108886467) has the molecular formula C11H16N2O3S and a molecular weight of 256.33 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-(2-sulfanylphenyl)urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-(2-sulfanylphenyl)urea |
|---|---|
| PubChem CID | 108886467 |
| Molecular Formula | C11H16N2O3S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-(2-sulfanylphenyl)urea |
| SMILES | COC(CNC(=O)Nc1ccccc1S)OC |
| InChI | InChI=1S/C11H16N2O3S/c1-15-10(16-2)7-12-11(14)13-8-5-3-4-6-9(8)17/h3-6,10,17H,7H2,1-2H3,(H2,12,13,14) |
| InChIKey | XCVGINJVAGRDRI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|