C12H17BrN2O3 — CID 127586988
1-(4-bromo-3-methylphenyl)-3-(2,2-dimethoxyethyl)urea (PubChem CID 127586988) has the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. Its IUPAC name is 1-(4-bromo-3-methylphenyl)-3-(2,2-dimethoxyethyl)urea.
| Compound Name | 1-(4-bromo-3-methylphenyl)-3-(2,2-dimethoxyethyl)urea |
|---|---|
| PubChem CID | 127586988 |
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 1-(4-bromo-3-methylphenyl)-3-(2,2-dimethoxyethyl)urea |
| SMILES | COC(CNC(=O)Nc1ccc(Br)c(C)c1)OC |
| InChI | InChI=1S/C12H17BrN2O3/c1-8-6-9(4-5-10(8)13)15-12(16)14-7-11(17-2)18-3/h4-6,11H,7H2,1-3H3,(H2,14,15,16) |
| InChIKey | BUSOFECLPOHRGW-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|