C21H27BrN4O3 — CID 137407284
1-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-3-(2,2-dimethoxyethyl)urea (PubChem CID 137407284) has the molecular formula C21H27BrN4O3 and a molecular weight of 463.38 g/mol. Its IUPAC name is 1-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-3-(2,2-dimethoxyethyl)urea.
| Compound Name | 1-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-3-(2,2-dimethoxyethyl)urea |
|---|---|
| PubChem CID | 137407284 |
| Molecular Formula | C21H27BrN4O3 |
| Molecular Weight | 463.38 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 1-[4-[4-(4-bromophenyl)piperazin-1-yl]phenyl]-3-(2,2-dimethoxyethyl)urea |
| SMILES | COC(CNC(=O)Nc1ccc(N2CCN(c3ccc(Br)cc3)CC2)cc1)OC |
| InChI | InChI=1S/C21H27BrN4O3/c1-28-20(29-2)15-23-21(27)24-17-5-9-19(10-6-17)26-13-11-25(12-14-26)18-7-3-16(22)4-8-18/h3-10,20H,11-15H2,1-2H3,(H2,23,24,27) |
| InChIKey | LIVQJYLJYDMHAT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.38 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|