C11H16N2O2 — CID 82492490
(4-ethoxy-2,5-dimethylphenyl)urea (PubChem CID 82492490) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (4-ethoxy-2,5-dimethylphenyl)urea.
| Compound Name | (4-ethoxy-2,5-dimethylphenyl)urea |
|---|---|
| PubChem CID | 82492490 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (4-ethoxy-2,5-dimethylphenyl)urea |
| SMILES | CCOc1cc(C)c(NC(N)=O)cc1C |
| InChI | InChI=1S/C11H16N2O2/c1-4-15-10-6-7(2)9(5-8(10)3)13-11(12)14/h5-6H,4H2,1-3H3,(H3,12,13,14) |
| InChIKey | HIULNWLDIZCANY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |