C10H8ClN3O3 — CID 75413422
4-chloro-N'-(furan-3-carbonyl)-1H-pyrrole-2-carbohydrazide (PubChem CID 75413422) has the molecular formula C10H8ClN3O3 and a molecular weight of 253.65 g/mol. Its IUPAC name is 4-chloro-N'-(furan-3-carbonyl)-1H-pyrrole-2-carbohydrazide.
| Compound Name | 4-chloro-N'-(furan-3-carbonyl)-1H-pyrrole-2-carbohydrazide |
|---|---|
| PubChem CID | 75413422 |
| Molecular Formula | C10H8ClN3O3 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4-chloro-N'-(furan-3-carbonyl)-1H-pyrrole-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1cc(Cl)c[nH]1)c1ccoc1 |
| InChI | InChI=1S/C10H8ClN3O3/c11-7-3-8(12-4-7)10(16)14-13-9(15)6-1-2-17-5-6/h1-5,12H,(H,13,15)(H,14,16) |
| InChIKey | YJIDPRMYZYYCQJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|