C12H19N3O5S3 — CID 167983701
3-[2-[[4-(dimethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 167983701) has the molecular formula C12H19N3O5S3 and a molecular weight of 381.50 g/mol. Its IUPAC name is 3-[2-[[4-(dimethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[4-(dimethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 167983701 |
| Molecular Formula | C12H19N3O5S3 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-[2-[[4-(dimethylsulfamoyl)-1H-pyrrole-2-carbonyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CN(C)S(=O)(=O)c1c[nH]c(C(=O)NCCSSCCC(=O)O)c1 |
| InChI | InChI=1S/C12H19N3O5S3/c1-15(2)23(19,20)9-7-10(14-8-9)12(18)13-4-6-22-21-5-3-11(16)17/h7-8,14H,3-6H2,1-2H3,(H,13,18)(H,16,17) |
| InChIKey | NLTSRLKQTWITFY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|