C16H23ClN2O5S3 — CID 166422612
3-[2-[[5-(tert-butylsulfamoyl)-2-chlorobenzoyl]amino]ethyldisulfanyl]propanoic acid (PubChem CID 166422612) has the molecular formula C16H23ClN2O5S3 and a molecular weight of 455.02 g/mol. Its IUPAC name is 3-[2-[[5-(tert-butylsulfamoyl)-2-chlorobenzoyl]amino]ethyldisulfanyl]propanoic acid.
| Compound Name | 3-[2-[[5-(tert-butylsulfamoyl)-2-chlorobenzoyl]amino]ethyldisulfanyl]propanoic acid |
|---|---|
| PubChem CID | 166422612 |
| Molecular Formula | C16H23ClN2O5S3 |
| Molecular Weight | 455.02 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 3-[2-[[5-(tert-butylsulfamoyl)-2-chlorobenzoyl]amino]ethyldisulfanyl]propanoic acid |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccc(Cl)c(C(=O)NCCSSCCC(=O)O)c1 |
| InChI | InChI=1S/C16H23ClN2O5S3/c1-16(2,3)19-27(23,24)11-4-5-13(17)12(10-11)15(22)18-7-9-26-25-8-6-14(20)21/h4-5,10,19H,6-9H2,1-3H3,(H,18,22)(H,20,21) |
| InChIKey | KTZCNMRWUNKODT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.02 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|