C13H11N3O4S — CID 62981433
4-[(4-cyanophenyl)-methylsulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 62981433) has the molecular formula C13H11N3O4S and a molecular weight of 305.32 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)-methylsulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[(4-cyanophenyl)-methylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 62981433 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 4-[(4-cyanophenyl)-methylsulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CN(c1ccc(C#N)cc1)S(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C13H11N3O4S/c1-16(10-4-2-9(7-14)3-5-10)21(19,20)11-6-12(13(17)18)15-8-11/h2-6,8,15H,1H3,(H,17,18) |
| InChIKey | XPWXKMUTMSATJU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |