C16H17N3O4S — CID 167885299
4-[ethyl(1H-indol-5-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid (PubChem CID 167885299) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 4-[ethyl(1H-indol-5-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-[ethyl(1H-indol-5-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 167885299 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 4-[ethyl(1H-indol-5-ylmethyl)sulfamoyl]-1H-pyrrole-2-carboxylic acid |
| SMILES | CCN(Cc1ccc2[nH]ccc2c1)S(=O)(=O)c1c[nH]c(C(=O)O)c1 |
| InChI | InChI=1S/C16H17N3O4S/c1-2-19(10-11-3-4-14-12(7-11)5-6-17-14)24(22,23)13-8-15(16(20)21)18-9-13/h3-9,17-18H,2,10H2,1H3,(H,20,21) |
| InChIKey | VGIGZPKJQLCBKX-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 106.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |