C11H15NO7S — CID 62805395
4-[(2-ethoxy-2-oxoethyl)-methylsulfamoyl]-5-methylfuran-2-carboxylic acid (PubChem CID 62805395) has the molecular formula C11H15NO7S and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-[(2-ethoxy-2-oxoethyl)-methylsulfamoyl]-5-methylfuran-2-carboxylic acid.
| Compound Name | 4-[(2-ethoxy-2-oxoethyl)-methylsulfamoyl]-5-methylfuran-2-carboxylic acid |
|---|---|
| PubChem CID | 62805395 |
| Molecular Formula | C11H15NO7S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-[(2-ethoxy-2-oxoethyl)-methylsulfamoyl]-5-methylfuran-2-carboxylic acid |
| SMILES | CCOC(=O)CN(C)S(=O)(=O)c1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C11H15NO7S/c1-4-18-10(13)6-12(3)20(16,17)9-5-8(11(14)15)19-7(9)2/h5H,4,6H2,1-3H3,(H,14,15) |
| InChIKey | YVLXWLQZMNLUFI-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 114.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |