C10H15NO5S — CID 62804138
5-methyl-4-[methyl(propyl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 62804138) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is 5-methyl-4-[methyl(propyl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-methyl-4-[methyl(propyl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62804138 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | 5-methyl-4-[methyl(propyl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | CCCN(C)S(=O)(=O)c1cc(C(=O)O)oc1C |
| InChI | InChI=1S/C10H15NO5S/c1-4-5-11(3)17(14,15)9-6-8(10(12)13)16-7(9)2/h6H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | XARPWZCVVOQKGA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |