C11H16BrNO5S — CID 62803983
5-bromo-4-[methyl(pentyl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 62803983) has the molecular formula C11H16BrNO5S and a molecular weight of 354.22 g/mol. Its IUPAC name is 5-bromo-4-[methyl(pentyl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[methyl(pentyl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62803983 |
| Molecular Formula | C11H16BrNO5S |
| Molecular Weight | 354.22 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 5-bromo-4-[methyl(pentyl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | CCCCCN(C)S(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C11H16BrNO5S/c1-3-4-5-6-13(2)19(16,17)9-7-8(11(14)15)18-10(9)12/h7H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | CKMBNJBDBCISNU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|