C13H20BrNO5S — CID 62831095
5-bromo-4-[pentyl(propan-2-yl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 62831095) has the molecular formula C13H20BrNO5S and a molecular weight of 382.28 g/mol. Its IUPAC name is 5-bromo-4-[pentyl(propan-2-yl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[pentyl(propan-2-yl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62831095 |
| Molecular Formula | C13H20BrNO5S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | 5-bromo-4-[pentyl(propan-2-yl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | CCCCCN(C(C)C)S(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C13H20BrNO5S/c1-4-5-6-7-15(9(2)3)21(18,19)11-8-10(13(16)17)20-12(11)14/h8-9H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | SNCMQMKIZSRXNQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|