C11H14BrNO5S — CID 62803816
5-bromo-4-[cyclopentyl(methyl)sulfamoyl]furan-2-carboxylic acid (PubChem CID 62803816) has the molecular formula C11H14BrNO5S and a molecular weight of 352.21 g/mol. Its IUPAC name is 5-bromo-4-[cyclopentyl(methyl)sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[cyclopentyl(methyl)sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62803816 |
| Molecular Formula | C11H14BrNO5S |
| Molecular Weight | 352.21 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 5-bromo-4-[cyclopentyl(methyl)sulfamoyl]furan-2-carboxylic acid |
| SMILES | CN(C1CCCC1)S(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C11H14BrNO5S/c1-13(7-4-2-3-5-7)19(16,17)9-6-8(11(14)15)18-10(9)12/h6-7H,2-5H2,1H3,(H,14,15) |
| InChIKey | WPYNYIAKROJGNI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |