C12H16BrNO5S — CID 62803810
5-bromo-4-(cyclohexylmethylsulfamoyl)furan-2-carboxylic acid (PubChem CID 62803810) has the molecular formula C12H16BrNO5S and a molecular weight of 366.23 g/mol. Its IUPAC name is 5-bromo-4-(cyclohexylmethylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-(cyclohexylmethylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62803810 |
| Molecular Formula | C12H16BrNO5S |
| Molecular Weight | 366.23 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 5-bromo-4-(cyclohexylmethylsulfamoyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC2CCCCC2)c(Br)o1 |
| InChI | InChI=1S/C12H16BrNO5S/c13-11-10(6-9(19-11)12(15)16)20(17,18)14-7-8-4-2-1-3-5-8/h6,8,14H,1-5,7H2,(H,15,16) |
| InChIKey | JEURMDKVJHHGRB-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |