C10H8BrNO5S2 — CID 63247995
5-bromo-4-(thiophen-3-ylmethylsulfamoyl)furan-2-carboxylic acid (PubChem CID 63247995) has the molecular formula C10H8BrNO5S2 and a molecular weight of 366.21 g/mol. Its IUPAC name is 5-bromo-4-(thiophen-3-ylmethylsulfamoyl)furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-(thiophen-3-ylmethylsulfamoyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63247995 |
| Molecular Formula | C10H8BrNO5S2 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 364.90 |
| IUPAC Name | 5-bromo-4-(thiophen-3-ylmethylsulfamoyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCc2ccsc2)c(Br)o1 |
| InChI | InChI=1S/C10H8BrNO5S2/c11-9-8(3-7(17-9)10(13)14)19(15,16)12-4-6-1-2-18-5-6/h1-3,5,12H,4H2,(H,13,14) |
| InChIKey | DNGGSEDPOYLRMG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |