C12H16BrNO6S — CID 65105358
5-bromo-4-[(1-hydroxycyclohexyl)methylsulfamoyl]furan-2-carboxylic acid (PubChem CID 65105358) has the molecular formula C12H16BrNO6S and a molecular weight of 382.23 g/mol. Its IUPAC name is 5-bromo-4-[(1-hydroxycyclohexyl)methylsulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(1-hydroxycyclohexyl)methylsulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 65105358 |
| Molecular Formula | C12H16BrNO6S |
| Molecular Weight | 382.23 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 5-bromo-4-[(1-hydroxycyclohexyl)methylsulfamoyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NCC2(O)CCCCC2)c(Br)o1 |
| InChI | InChI=1S/C12H16BrNO6S/c13-10-9(6-8(20-10)11(15)16)21(18,19)14-7-12(17)4-2-1-3-5-12/h6,14,17H,1-5,7H2,(H,15,16) |
| InChIKey | UAFAGVHBHQFUSZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |