C11H14BrNO7S — CID 106297009
5-bromo-4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 106297009) has the molecular formula C11H14BrNO7S and a molecular weight of 384.20 g/mol. Its IUPAC name is 5-bromo-4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106297009 |
| Molecular Formula | C11H14BrNO7S |
| Molecular Weight | 384.20 g/mol |
| Exact Mass | 382.97 |
| IUPAC Name | 5-bromo-4-[[4-(hydroxymethyl)oxan-4-yl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NC2(CO)CCOCC2)c(Br)o1 |
| InChI | InChI=1S/C11H14BrNO7S/c12-9-8(5-7(20-9)10(15)16)21(17,18)13-11(6-14)1-3-19-4-2-11/h5,13-14H,1-4,6H2,(H,15,16) |
| InChIKey | YACACYBTDKKSLK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.20 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |