C11H14BrNO6S — CID 62829187
5-bromo-4-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]furan-2-carboxylic acid (PubChem CID 62829187) has the molecular formula C11H14BrNO6S and a molecular weight of 368.21 g/mol. Its IUPAC name is 5-bromo-4-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 62829187 |
| Molecular Formula | C11H14BrNO6S |
| Molecular Weight | 368.21 g/mol |
| Exact Mass | 366.97 |
| IUPAC Name | 5-bromo-4-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)NC2(CO)CCCC2)c(Br)o1 |
| InChI | InChI=1S/C11H14BrNO6S/c12-9-8(5-7(19-9)10(15)16)20(17,18)13-11(6-14)3-1-2-4-11/h5,13-14H,1-4,6H2,(H,15,16) |
| InChIKey | NZIFRPVDZSDGCF-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.21 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |