C13H16ClNO5S — CID 62518209
4-chloro-3-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]benzoic acid (PubChem CID 62518209) has the molecular formula C13H16ClNO5S and a molecular weight of 333.79 g/mol. Its IUPAC name is 4-chloro-3-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]benzoic acid.
| Compound Name | 4-chloro-3-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 62518209 |
| Molecular Formula | C13H16ClNO5S |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 4-chloro-3-[[1-(hydroxymethyl)cyclopentyl]sulfamoyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cl)c(S(=O)(=O)NC2(CO)CCCC2)c1 |
| InChI | InChI=1S/C13H16ClNO5S/c14-10-4-3-9(12(17)18)7-11(10)21(19,20)15-13(8-16)5-1-2-6-13/h3-4,7,15-16H,1-2,5-6,8H2,(H,17,18) |
| InChIKey | WMOTWMAUPHWZPM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |