C9H13BrN2O7S2 — CID 106334960
5-bromo-4-[3-(methanesulfonamido)propylsulfamoyl]furan-2-carboxylic acid (PubChem CID 106334960) has the molecular formula C9H13BrN2O7S2 and a molecular weight of 405.25 g/mol. Its IUPAC name is 5-bromo-4-[3-(methanesulfonamido)propylsulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[3-(methanesulfonamido)propylsulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 106334960 |
| Molecular Formula | C9H13BrN2O7S2 |
| Molecular Weight | 405.25 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | 5-bromo-4-[3-(methanesulfonamido)propylsulfamoyl]furan-2-carboxylic acid |
| SMILES | CS(=O)(=O)NCCCNS(=O)(=O)c1cc(C(=O)O)oc1Br |
| InChI | InChI=1S/C9H13BrN2O7S2/c1-20(15,16)11-3-2-4-12-21(17,18)7-5-6(9(13)14)19-8(7)10/h5,11-12H,2-4H2,1H3,(H,13,14) |
| InChIKey | SYDIZGGVJHOAMA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 142.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.25 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|