C12H15Br2NO4S — CID 106299191
2,5-dibromo-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide (PubChem CID 106299191) has the molecular formula C12H15Br2NO4S and a molecular weight of 429.13 g/mol. Its IUPAC name is 2,5-dibromo-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 106299191 |
| Molecular Formula | C12H15Br2NO4S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.91 |
| IUPAC Name | 2,5-dibromo-N-[4-(hydroxymethyl)oxan-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1(CO)CCOCC1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H15Br2NO4S/c13-9-1-2-10(14)11(7-9)20(17,18)15-12(8-16)3-5-19-6-4-12/h1-2,7,15-16H,3-6,8H2 |
| InChIKey | FWJZSROPCPPEIG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |