C11H11Br2NO4S — CID 81164987
1-[(2,5-dibromophenyl)sulfonylamino]cyclobutane-1-carboxylic acid (PubChem CID 81164987) has the molecular formula C11H11Br2NO4S and a molecular weight of 413.09 g/mol. Its IUPAC name is 1-[(2,5-dibromophenyl)sulfonylamino]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[(2,5-dibromophenyl)sulfonylamino]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 81164987 |
| Molecular Formula | C11H11Br2NO4S |
| Molecular Weight | 413.09 g/mol |
| Exact Mass | 410.88 |
| IUPAC Name | 1-[(2,5-dibromophenyl)sulfonylamino]cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(NS(=O)(=O)c2cc(Br)ccc2Br)CCC1 |
| InChI | InChI=1S/C11H11Br2NO4S/c12-7-2-3-8(13)9(6-7)19(17,18)14-11(10(15)16)4-1-5-11/h2-3,6,14H,1,4-5H2,(H,15,16) |
| InChIKey | XRRJJDQZYPINHR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.09 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |