C10H15N3O6S — CID 106298863
N-[4-(hydroxymethyl)oxan-4-yl]-2,4-dioxo-1H-pyrimidine-5-sulfonamide (PubChem CID 106298863) has the molecular formula C10H15N3O6S and a molecular weight of 305.31 g/mol. Its IUPAC name is N-[4-(hydroxymethyl)oxan-4-yl]-2,4-dioxo-1H-pyrimidine-5-sulfonamide.
| Compound Name | N-[4-(hydroxymethyl)oxan-4-yl]-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 106298863 |
| Molecular Formula | C10H15N3O6S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-[4-(hydroxymethyl)oxan-4-yl]-2,4-dioxo-1H-pyrimidine-5-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)NC2(CO)CCOCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H15N3O6S/c14-6-10(1-3-19-4-2-10)13-20(17,18)7-5-11-9(16)12-8(7)15/h5,13-14H,1-4,6H2,(H2,11,12,15,16) |
| InChIKey | HLIUWCDTRXBLQS-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 141.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |