C11H15BrN2O6S — CID 79079920
5-bromo-4-[(4-methylmorpholin-2-yl)methylsulfamoyl]furan-2-carboxylic acid (PubChem CID 79079920) has the molecular formula C11H15BrN2O6S and a molecular weight of 383.22 g/mol. Its IUPAC name is 5-bromo-4-[(4-methylmorpholin-2-yl)methylsulfamoyl]furan-2-carboxylic acid.
| Compound Name | 5-bromo-4-[(4-methylmorpholin-2-yl)methylsulfamoyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 79079920 |
| Molecular Formula | C11H15BrN2O6S |
| Molecular Weight | 383.22 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | 5-bromo-4-[(4-methylmorpholin-2-yl)methylsulfamoyl]furan-2-carboxylic acid |
| SMILES | CN1CCOC(CNS(=O)(=O)c2cc(C(=O)O)oc2Br)C1 |
| InChI | InChI=1S/C11H15BrN2O6S/c1-14-2-3-19-7(6-14)5-13-21(17,18)9-4-8(11(15)16)20-10(9)12/h4,7,13H,2-3,5-6H2,1H3,(H,15,16) |
| InChIKey | GKQPFURNHHVXHO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.22 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |