C12H18ClN3O3S — CID 79083271
2-amino-4-chloro-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide (PubChem CID 79083271) has the molecular formula C12H18ClN3O3S and a molecular weight of 319.81 g/mol. Its IUPAC name is 2-amino-4-chloro-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 2-amino-4-chloro-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79083271 |
| Molecular Formula | C12H18ClN3O3S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 2-amino-4-chloro-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide |
| SMILES | CN1CCOC(CNS(=O)(=O)c2ccc(Cl)cc2N)C1 |
| InChI | InChI=1S/C12H18ClN3O3S/c1-16-4-5-19-10(8-16)7-15-20(17,18)12-3-2-9(13)6-11(12)14/h2-3,6,10,15H,4-5,7-8,14H2,1H3 |
| InChIKey | RMUJYMSACCLWPC-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|