C14H23N3O3S — CID 79083047
3-(1-aminoethyl)-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide (PubChem CID 79083047) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 3-(1-aminoethyl)-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide.
| Compound Name | 3-(1-aminoethyl)-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79083047 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 3-(1-aminoethyl)-N-[(4-methylmorpholin-2-yl)methyl]benzenesulfonamide |
| SMILES | CC(N)c1cccc(S(=O)(=O)NCC2CN(C)CCO2)c1 |
| InChI | InChI=1S/C14H23N3O3S/c1-11(15)12-4-3-5-14(8-12)21(18,19)16-9-13-10-17(2)6-7-20-13/h3-5,8,11,13,16H,6-7,9-10,15H2,1-2H3 |
| InChIKey | DCODAKSFJUSGPX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |