C13H19N3O3S2 — CID 79083016
3-[(4-methylmorpholin-2-yl)methylsulfamoyl]benzenecarbothioamide (PubChem CID 79083016) has the molecular formula C13H19N3O3S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 3-[(4-methylmorpholin-2-yl)methylsulfamoyl]benzenecarbothioamide.
| Compound Name | 3-[(4-methylmorpholin-2-yl)methylsulfamoyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 79083016 |
| Molecular Formula | C13H19N3O3S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 3-[(4-methylmorpholin-2-yl)methylsulfamoyl]benzenecarbothioamide |
| SMILES | CN1CCOC(CNS(=O)(=O)c2cccc(C(N)=S)c2)C1 |
| InChI | InChI=1S/C13H19N3O3S2/c1-16-5-6-19-11(9-16)8-15-21(17,18)12-4-2-3-10(7-12)13(14)20/h2-4,7,11,15H,5-6,8-9H2,1H3,(H2,14,20) |
| InChIKey | YWNJYEWOZLMDMZ-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|