4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride

C13H20ClNO3S2 — CID 65370094

IUPAC4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride
SMILESCCCCN(CCCC)C(=O)c1csc(S(=O)(=O)Cl)c1
InChIInChI=1S/C13H20ClNO3S2/c1-3-5-7-15(8-6-4-2)13(16)11-9-12(19-10-11)20(14,17)18/h9-10H,3-8H2,1-2H3
InChIKeyLENUWRQSNLCGIB-UHFFFAOYSA-N
MW337.89 g/mol
LogP3.72
Rot. Bonds8

About 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride

4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride (PubChem CID 65370094) has the molecular formula C13H20ClNO3S2 and a molecular weight of 337.89 g/mol. Its IUPAC name is 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride.

Molecular Properties

Compound Name4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride
PubChem CID65370094
Molecular FormulaC13H20ClNO3S2
Molecular Weight337.89 g/mol
Exact Mass337.06
IUPAC Name4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride
SMILESCCCCN(CCCC)C(=O)c1csc(S(=O)(=O)Cl)c1
InChIInChI=1S/C13H20ClNO3S2/c1-3-5-7-15(8-6-4-2)13(16)11-9-12(19-10-11)20(14,17)18/h9-10H,3-8H2,1-2H3
InChIKeyLENUWRQSNLCGIB-UHFFFAOYSA-N
XLogP3.72
TPSA54.45 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500337.89
LogP ≤ 53.72
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride?
The IUPAC name of 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride (CID 65370094) is 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride.
What is the SMILES notation for 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride?
The canonical SMILES for 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride is CCCCN(CCCC)C(=O)c1csc(S(=O)(=O)Cl)c1.
What is the InChIKey of 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride?
The InChIKey is LENUWRQSNLCGIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20ClNO3S2/c1-3-5-7-15(8-6-4-2)13(16)11-9-12(19-10-11)20(14,17)18/h9-10H,3-8H2,1-2H3.
What are the key properties of 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride?
4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride has a molecular weight of 337.89 g/mol, XLogP of 3.72, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibutylcarbamoyl)thiophene-2-sulfonyl chloride is sourced from PubChem (CID 65370094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).