4-(dibutylcarbamoyl)benzenesulfonyl chloride

C15H22ClNO3S — CID 43125989

IUPAC4-(dibutylcarbamoyl)benzenesulfonyl chloride
SMILESCCCCN(CCCC)C(=O)c1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C15H22ClNO3S/c1-3-5-11-17(12-6-4-2)15(18)13-7-9-14(10-8-13)21(16,19)20/h7-10H,3-6,11-12H2,1-2H3
InChIKeyQXCHQLAVXQZNNK-UHFFFAOYSA-N
MW331.86 g/mol
LogP3.66
Rot. Bonds8

About 4-(dibutylcarbamoyl)benzenesulfonyl chloride

4-(dibutylcarbamoyl)benzenesulfonyl chloride (PubChem CID 43125989) has the molecular formula C15H22ClNO3S and a molecular weight of 331.86 g/mol. Its IUPAC name is 4-(dibutylcarbamoyl)benzenesulfonyl chloride.

Molecular Properties

Compound Name4-(dibutylcarbamoyl)benzenesulfonyl chloride
PubChem CID43125989
Molecular FormulaC15H22ClNO3S
Molecular Weight331.86 g/mol
Exact Mass331.10
IUPAC Name4-(dibutylcarbamoyl)benzenesulfonyl chloride
SMILESCCCCN(CCCC)C(=O)c1ccc(S(=O)(=O)Cl)cc1
InChIInChI=1S/C15H22ClNO3S/c1-3-5-11-17(12-6-4-2)15(18)13-7-9-14(10-8-13)21(16,19)20/h7-10H,3-6,11-12H2,1-2H3
InChIKeyQXCHQLAVXQZNNK-UHFFFAOYSA-N
XLogP3.66
TPSA54.45 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500331.86
LogP ≤ 53.66
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 4-(dibutylcarbamoyl)benzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(dibutylcarbamoyl)benzenesulfonyl chloride?
The IUPAC name of 4-(dibutylcarbamoyl)benzenesulfonyl chloride (CID 43125989) is 4-(dibutylcarbamoyl)benzenesulfonyl chloride.
What is the SMILES notation for 4-(dibutylcarbamoyl)benzenesulfonyl chloride?
The canonical SMILES for 4-(dibutylcarbamoyl)benzenesulfonyl chloride is CCCCN(CCCC)C(=O)c1ccc(S(=O)(=O)Cl)cc1.
What is the InChIKey of 4-(dibutylcarbamoyl)benzenesulfonyl chloride?
The InChIKey is QXCHQLAVXQZNNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22ClNO3S/c1-3-5-11-17(12-6-4-2)15(18)13-7-9-14(10-8-13)21(16,19)20/h7-10H,3-6,11-12H2,1-2H3.
What are the key properties of 4-(dibutylcarbamoyl)benzenesulfonyl chloride?
4-(dibutylcarbamoyl)benzenesulfonyl chloride has a molecular weight of 331.86 g/mol, XLogP of 3.66, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(dibutylcarbamoyl)benzenesulfonyl chloride is sourced from PubChem (CID 43125989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).