C13H15ClFNO4S — CID 104654996
2-chloro-3-fluoro-5-[methyl(pent-4-enyl)sulfamoyl]benzoic acid (PubChem CID 104654996) has the molecular formula C13H15ClFNO4S and a molecular weight of 335.78 g/mol. Its IUPAC name is 2-chloro-3-fluoro-5-[methyl(pent-4-enyl)sulfamoyl]benzoic acid.
| Compound Name | 2-chloro-3-fluoro-5-[methyl(pent-4-enyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 104654996 |
| Molecular Formula | C13H15ClFNO4S |
| Molecular Weight | 335.78 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 2-chloro-3-fluoro-5-[methyl(pent-4-enyl)sulfamoyl]benzoic acid |
| SMILES | C=CCCCN(C)S(=O)(=O)c1cc(F)c(Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H15ClFNO4S/c1-3-4-5-6-16(2)21(19,20)9-7-10(13(17)18)12(14)11(15)8-9/h3,7-8H,1,4-6H2,2H3,(H,17,18) |
| InChIKey | OAWUPUANRPQFFB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.78 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|