C13H19FN2O4S — CID 63693254
5-[3-(dimethylamino)propyl-methylsulfamoyl]-2-fluorobenzoic acid (PubChem CID 63693254) has the molecular formula C13H19FN2O4S and a molecular weight of 318.37 g/mol. Its IUPAC name is 5-[3-(dimethylamino)propyl-methylsulfamoyl]-2-fluorobenzoic acid.
| Compound Name | 5-[3-(dimethylamino)propyl-methylsulfamoyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 63693254 |
| Molecular Formula | C13H19FN2O4S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 5-[3-(dimethylamino)propyl-methylsulfamoyl]-2-fluorobenzoic acid |
| SMILES | CN(C)CCCN(C)S(=O)(=O)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H19FN2O4S/c1-15(2)7-4-8-16(3)21(19,20)10-5-6-12(14)11(9-10)13(17)18/h5-6,9H,4,7-8H2,1-3H3,(H,17,18) |
| InChIKey | XXBIOXAAVOBCSR-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |