C9H11FNO4PS — CID 155444287
2-fluoro-5-[methyl(phosphanylmethyl)sulfamoyl]benzoic acid (PubChem CID 155444287) has the molecular formula C9H11FNO4PS and a molecular weight of 279.23 g/mol. Its IUPAC name is 2-fluoro-5-[methyl(phosphanylmethyl)sulfamoyl]benzoic acid.
| Compound Name | 2-fluoro-5-[methyl(phosphanylmethyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 155444287 |
| Molecular Formula | C9H11FNO4PS |
| Molecular Weight | 279.23 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-fluoro-5-[methyl(phosphanylmethyl)sulfamoyl]benzoic acid |
| SMILES | CN(CP)S(=O)(=O)c1ccc(F)c(C(=O)O)c1 |
| InChI | InChI=1S/C9H11FNO4PS/c1-11(5-16)17(14,15)6-2-3-8(10)7(4-6)9(12)13/h2-4H,5,16H2,1H3,(H,12,13) |
| InChIKey | SJULCZKTQUSGQP-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|