C16H16FNO4S — CID 71890309
5-[(2,4-dimethylphenyl)-methylsulfamoyl]-2-fluorobenzoic acid (PubChem CID 71890309) has the molecular formula C16H16FNO4S and a molecular weight of 337.37 g/mol. Its IUPAC name is 5-[(2,4-dimethylphenyl)-methylsulfamoyl]-2-fluorobenzoic acid.
| Compound Name | 5-[(2,4-dimethylphenyl)-methylsulfamoyl]-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 71890309 |
| Molecular Formula | C16H16FNO4S |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 5-[(2,4-dimethylphenyl)-methylsulfamoyl]-2-fluorobenzoic acid |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2ccc(F)c(C(=O)O)c2)c(C)c1 |
| InChI | InChI=1S/C16H16FNO4S/c1-10-4-7-15(11(2)8-10)18(3)23(21,22)12-5-6-14(17)13(9-12)16(19)20/h4-9H,1-3H3,(H,19,20) |
| InChIKey | DBHRACDVLKHSBV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |