C13H14FNO5S — CID 61489074
5-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid (PubChem CID 61489074) has the molecular formula C13H14FNO5S and a molecular weight of 315.32 g/mol. Its IUPAC name is 5-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid.
| Compound Name | 5-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid |
|---|---|
| PubChem CID | 61489074 |
| Molecular Formula | C13H14FNO5S |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 5-[2-[cyclopropyl(methyl)amino]-2-oxoethyl]sulfonyl-2-fluorobenzoic acid |
| SMILES | CN(C(=O)CS(=O)(=O)c1ccc(F)c(C(=O)O)c1)C1CC1 |
| InChI | InChI=1S/C13H14FNO5S/c1-15(8-2-3-8)12(16)7-21(19,20)9-4-5-11(14)10(6-9)13(17)18/h4-6,8H,2-3,7H2,1H3,(H,17,18) |
| InChIKey | PNZWFOUCCTZSEA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |