C9H6F4O4S — CID 43323585
2-fluoro-5-(2,2,2-trifluoroethylsulfonyl)benzoic acid (PubChem CID 43323585) has the molecular formula C9H6F4O4S and a molecular weight of 286.20 g/mol. Its IUPAC name is 2-fluoro-5-(2,2,2-trifluoroethylsulfonyl)benzoic acid.
| Compound Name | 2-fluoro-5-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43323585 |
| Molecular Formula | C9H6F4O4S |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 2-fluoro-5-(2,2,2-trifluoroethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)CC(F)(F)F)ccc1F |
| InChI | InChI=1S/C9H6F4O4S/c10-7-2-1-5(3-6(7)8(14)15)18(16,17)4-9(11,12)13/h1-3H,4H2,(H,14,15) |
| InChIKey | PHHBBZDVPFWMID-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |