C10H7FN2O5S — CID 43323578
2-fluoro-5-(1,2,4-oxadiazol-3-ylmethylsulfonyl)benzoic acid (PubChem CID 43323578) has the molecular formula C10H7FN2O5S and a molecular weight of 286.24 g/mol. Its IUPAC name is 2-fluoro-5-(1,2,4-oxadiazol-3-ylmethylsulfonyl)benzoic acid.
| Compound Name | 2-fluoro-5-(1,2,4-oxadiazol-3-ylmethylsulfonyl)benzoic acid |
|---|---|
| PubChem CID | 43323578 |
| Molecular Formula | C10H7FN2O5S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 2-fluoro-5-(1,2,4-oxadiazol-3-ylmethylsulfonyl)benzoic acid |
| SMILES | O=C(O)c1cc(S(=O)(=O)Cc2ncon2)ccc1F |
| InChI | InChI=1S/C10H7FN2O5S/c11-8-2-1-6(3-7(8)10(14)15)19(16,17)4-9-12-5-18-13-9/h1-3,5H,4H2,(H,14,15) |
| InChIKey | JNVQNDUSHPUPIY-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 110.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |